| Identification |
| Name: | 2,3,4-Trifluoroaniline |
| Synonyms: | 2,3,4-Trifluorobenzenamine |
| CAS: | 3862-73-5 |
| EINECS: | 253-703-1 |
| Molecular Formula: | C6H4F3N |
| Molecular Weight: | 147.1 |
| InChI: | InChI=1/C6H4F3N/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3082 |
| Melting Point: | 14-15oC |
| Density: | 1.393 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.486-1.488 |
| Solubility: | Slightly soluble |
| Appearance: | Colorless To Light Yellow Liquid |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
