| Identification | |
| Name: | Guanosine,7,8-dihydro-8-oxo- |
| Synonyms: | Purine-6,8(1H,9H)-dione,2-amino-9-b-D-ribofuranosyl- (7CI,8CI);8-Hydroxyguanosine; 8-Oxo-7,8-dihydroguanosine; 8-Oxoguanosine; NSC 90393 |
| CAS: | 3868-31-3 |
| Molecular Formula: | C10H13 N5 O6 |
| Molecular Weight: | 299.28 |
| InChI: | InChI=1/C10H13N5O6/c11-9-13-6-3(7(19)14-9)12-10(20)15(6)8-5(18)4(17)2(1-16)21-8/h2,4-5,8,16-18H,1H2,(H,12,20)(H3,11,13,14,19) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 2.43g/cm3 |
| Refractive index: | 2.007 |
| Specification: |
8-Hydroxyguanosine , its CAS NO. is 3868-31-3, the synonyms are 2-Amino-9-beta-D-ribofuranosylpurine-6,8(1H,9H)-dione ; 8-Oxo-2'-deoxyguanosine ; 8-Oxoguanosine ; CCRIS 8242 ; NSC 90393 ; Guanosine, 7,8-dihydro-8-oxo- (9CI) ; Purine-6,8(1H,9H)-dione, 2-amino-9-beta-D-ribofuranosyl- . |
| Flash Point: | °C |
| Usage: |
8-Hydroxyguanosine (CAS NO.3868-31-3) is a nucleoside which is an oxidative derivative of guanosine. Measurement of the levels of 8-hydroxyguanosine is used as a biomarker of oxidative stress. |
| Safety Data | |
 |
|
