| Identification | |
| Name: | 4-Chloro-3-nitrobenzoyl chloride |
| Synonyms: | 3-nitro-4-chlorobenzoyl chloride; 3-nitro-4-chlorobenzoyl chloride |
| CAS: | 38818-50-7 |
| EINECS: | 254-133-6 |
| Molecular Formula: | C7H3Cl2NO3 |
| Molecular Weight: | 220.01 |
| InChI: | InChI=1/C7H3Cl2NO3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.575 g/cm3 |
| Stability: | Stable, but may be air and moisture sensitive. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.602 |
| Water Solubility: | Stability Stable, but may be air and moisture sensitive. Incompatible withstrong oxidizing agents.Toxicology Corrosive - causes burns. Lachrymator. Very destructive of mucousmembranes. |
| Solubility: | |
| Appearance: | powder or crystals |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. Corrosives area. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
