| Identification | |
| Name: | R-(+)-1-(1-naphthyl)ethylamine |
| Synonyms: | (R)-(+)-1-(1-Naphthyl)ethylamine |
| CAS: | 3886-70-2 |
| EINECS: | 223-425-5 |
| Molecular Formula: | C12H13N |
| Molecular Weight: | 171.24 |
| InChI: | InChI=1/C12H13N/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-9H,13H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2735 |
| Density: | 1.067 |
| Stability: | Stable. Air-sensitive. Incompatible with acids, oxidizing agents, acid anhydrides, chloroformates, acid chlorides. |
| Refractive index: | 1.6217-1.6237 |
| Alpha: | 60 o (C=2, CH3OH) |
| Appearance: | Clear slightly yellow liquid. |
| Specification: |
? (R)-(+)-1-(1-Naphthyl)ethylamine , with CAS number of 3886-70-2, can be called (R)-alpha-Methyl-1-naphthalenemethanamine ; 1-naphthalenemethanamine, alpha-methyl-, (alphaR)- ; 1-naphthalenemethanamine, a-methyl-, (aR)- ; 1-Naphthalenemethanamine, alpha-methyl-, (R)-(+)- ; (R)-alpha-Methyl-1-naphthalenemethanamine ; (1R)-1-(1-Naphthyl)ethanamine .?(R)-(+)-1-(1-Naphthyl)ethylamine (CAS NO.3886-70-2) should be stored under an inert atmosphere with?cool, dry, well-ventilated area away from incompatible substances. |
| Packinggroup: | II |
| Sensitive: | Air Sensitive |
| Color: | brown |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
