| Identification | |
| Name: | Ethyl 3-(m-hydroxyphenyl)-1-methyl-3-pyrolidinecarboxylate |
| Synonyms: | Ethyl=3-(3-hydroxyphenyl)-1-methyl-3-pyrrolidinecarboxylate |
| CAS: | 38906-58-0 |
| Molecular Formula: | C14H19NO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H19NO3/c1-3-18-13(17)14(7-8-15(2)10-14)11-5-4-6-12(16)9-11/h4-6,9,16H,3,7-8,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 178.2°C |
| Boiling Point: | 371°C at 760 mmHg |
| Density: | 1.159g/cm3 |
| Refractive index: | 1.55 |
| Specification: |
Ethyl 3-(m-hydroxyphenyl)-1-methyl-3-pyrolidinecarboxylate , its cas register number is 38906-58-0. It also can be called 5-22-05-00157 (Beilstein Handbook Reference) ; BRN 0411786 . When Ethyl 3-(m-hydroxyphenyl)-1-methyl-3-pyrolidinecarboxylate (CAS NO.38906-58-0) is heated to decomposition, it emits toxic vapors of NOx. |
| Flash Point: | 178.2°C |
| Safety Data | |
 |
|
