| Identification |
| Name: | Methanone,(3,4-diaminophenyl)phenyl- |
| Synonyms: | (3,4-Diaminophenyl)phenylmethanone;2-Amino-4-benzoylaniline;3,4-Benzophenonediamine;3,4-Diaminobenzophenone;4-Benzoyl-1,2-benzenediamine;4-Benzoyl-1,2-phenylenediamine;4-Benzoyl-o-phenylenediamine;p-Benzoyl-o-phenylenediamine; |
| CAS: | 39070-63-8 |
| EINECS: | 254-273-8 |
| Molecular Formula: | C13H12N2O |
| Molecular Weight: | 212.25 |
| InChI: | InChI=1/C13H12N2O/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h1-8H,14-15H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.233 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.673 |
| Solubility: | 410 mg/L (20 ºC) in water,Soluble in Methanol, |
| Appearance: | yellow to ochre-yellow powder |
| HS Code: | 29223900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
