Identification |
Name: | 2-Thiopheneacetyl chloride |
Synonyms: | 2-Thienylacetyl chloride;2-thiophen-2-ylacetyl chloride;Thiophene-2-acetyl chloride;2-Thiopheneacetyl chloride (TAC);2-Thiopheneacetylchloride;2-Thiophene acetyl chloride; |
CAS: | 39098-97-0 |
EINECS: | 254-290-0 |
Molecular Formula: | C6H5ClOS |
Molecular Weight: | 160.62 |
InChI: | InChI=1/C6H5ClOS/c7-6(8)4-5-2-1-3-9-5/h1-3H,4H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3265 |
Density: | 1.303 |
Stability: | Stable under normal temperatures and pressures. May decompose on exposure to moist air or water. Moisture sensitive. |
Refractive index: | 1.55 |
Appearance: | clear brown liquid |
Packinggroup: | III |
HS Code: | 29349990 |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |