| Identification |
| Name: | Benzeneacetic acid,4-mercapto- |
| Synonyms: | 2-(4-Mercaptophenyl)aceticacid;4-Mercaptophenylacetic acid;p-Mercaptophenylacetic acid; |
| CAS: | 39161-84-7 |
| Molecular Formula: | C8H8O2S |
| Molecular Weight: | 168.21 |
| InChI: | InChI=1/C8H8O2S/c9-8(10)5-6-1-3-7(11)4-2-6/h1-4,11H,5H2,(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 105-109 °C(lit.)
|
| Flash Point: | 157°C |
| Boiling Point: | 336°Cat760mmHg |
| Density: | 1.299g/cm3 |
| Refractive index: | 1.62 |
| Appearance: | White Powder |
| Flash Point: | 157°C |
| Sensitive: | Air Sensitive |
| Usage: | A redox buffer that increases the folding rate of disulfide-containing proteins realative to traditional buffers such as glutathione and glutathione-disulfide. A useful synthetic intermediate for the preparation of novel antiinflammatory agents. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
