| Identification | |
| Name: | Guanidine,N-ethyl-N'-nitro- |
| Synonyms: | Guanidine,1-ethyl-3-nitro- (6CI,7CI); 1-Ethyl-2-nitroguanidine; 1-Ethyl-3-nitroguanidine;N-Ethyl-N'-nitroguanidine |
| CAS: | 39197-62-1 |
| Molecular Formula: | C3H8 N4 O2 |
| Molecular Weight: | 132.15 |
| InChI: | InChI=1/C3H8N4O2/c1-2-5-3(4)6-7(8)9/h2H2,1H3,(H3,4,5,6) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.5°C |
| Boiling Point: | 259.1°Cat760mmHg |
| Density: | 1.44g/cm3 |
| Refractive index: | 1.567 |
| Specification: |
N-Ethyl-N'-nitroguanidine , its cas register number is 39197-62-1. It also can be called 4-04-00-00373 (Beilstein Handbook Reference) ; BRN 1770622 . When heated to decomposition it emits very toxic fumes of NOx. |
| Flash Point: | 110.5°C |
| Safety Data | |
 |
|
