| Identification | |
| Name: | 2,4-Dichloropyrimidine |
| Synonyms: | - |
| CAS: | 3934-20-1 |
| EINECS: | 223-508-6 |
| Molecular Formula: | C4H2Cl2N2 |
| Molecular Weight: | 148.98 |
| InChI: | InChI=1/C4H2Cl2N2/c5-3-1-2-7-4(6)8-3/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1759 |
| Density: | 1.493 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.559 |
| Solubility: | Slightly soluble |
| Appearance: | White Solid |
| Specification: |
? 2,4-Dichloropyrimidine ,?its cas register number is 3934-20-1. It also can be called?2,6-Dichloropyrimidine ; Pyrimidine, 2,4-dichloro- . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
