| Identification |
| Name: | Toluene diisocyanate, polypropylene glycol, beta-hydroxyethyl acrylate polymer |
| Synonyms: | 1,3-diisocyanato-2-methyl-benzene; 2-hydroxyethyl prop-2-enoate; 2-methoxyethanol;AC1L54MY;KST-1B4679;AC1Q6853;AR-1B6942;Toluene diisocyanate, polypropylene glycol, beta-hydroxyethyl acrylate polymer;1,3-diisocyanato-2-methylbenzene; 2-hydroxyethyl prop-2-enoate; 2-methoxyethanol;2-Propenoic acid, 2-hydroxyethyl ester, polymer with 1,3-diisocyanatomethylbenzene and alpha-hydro-omega-hydroxypoly(oxy(methyl-1,2-ethanediyl));37302-70-8 |
| CAS: | 39373-37-0 |
| Molecular Formula: | C17H22N2O7 |
| Molecular Weight: | 366.36578 |
| InChI: | InChI=1S/C9H6N2O2.C5H8O3.C3H8O2/c1-7-8(10-5-12)3-2-4-9(7)11-6-13;1-2-5(7)8-4-3-6;1-5-3-2-4/h2-4H,1H3;2,6H,1,3-4H2;4H,2-3H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 110.5°C |
| Boiling Point: | 248.4°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 110.5°C |
| Safety Data |
| |
 |
