| Identification | |
| Name: | 2-Fluorobenzonitrile |
| Synonyms: | Fluorobenzonitrile; ; FluorobenzonitrileFLUOROBENZONITRILE; 2-CYANOFLUOROBENZENE; O-FLUOROBENZONITRILE; Benzonitrile, o-fluoro-; o-Cyanofluorobenzene; o-Fluorobenzonitrile 2-Fluorobenzonitrile; 2-FLUOROBENZONITRILE 98% (GC); 2-Fluorobenzonitrile,99%; 2-Fluorobenzonitrile 99%; 2-Fluorbenzonitril; O-Fluorobenzonitile |
| CAS: | 394-47-8 |
| EINECS: | 206-897-7 |
| Molecular Formula: | C7H4FN |
| Molecular Weight: | 121.11 |
| InChI: | InChI=1/C7H4FN/c8-7-4-2-1-3-6(7)5-9/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3276 |
| Melting Point: | 35 - 37 |
| Density: | 1.116 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5063-1.5083 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | clear to white semi solid |
| Specification: |
?2-fluorobenzonitrile , its CAS NO. is 394-47-8, the synonyms are o-Cyanofluorobenzene ; o-Fluorobenzonitrile ; Benzonitrile, 2-fluoro- . |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
