| Identification | |
| Name: | 4-(4-chlorophenyl)-4-hydroxypiperidine |
| Synonyms: | 4-(4-Chlorophenyl)-4-hydroxypiperidine, crystalline; 4-(4-Chlorophenyl)-4-piperidinol; 4-(4-Chlorophenyl)piperidin-4-ol; TIMTEC-BB SBB003427; 4-(4-Chlorophehyl)-4-piperidinol; 4-(4-Chlorophenyl)piperidinol-4; 4-(p-Chlorophenyl)-4-piperidinol; 4-Hydroxy-4-(4-chlorophenyl)piperidine; 4-Hydroxy-4-(p-chlorophenyl)piperidine; 4-Piperidinol, 4-(4-chlorophenyl)-; 4-(CHLOROPHENYL)-4-HYDROXYLPIPERIDINE; Haloperidol |
| CAS: | 39512-49-7 |
| EINECS: | 254-479-8 |
| Molecular Formula: | C11H14ClNO |
| Molecular Weight: | 211.69 |
| InChI: | InChI=1/C11H14ClNO/c12-10-3-1-9(2-4-10)11(14)5-7-13-8-6-11/h1-4,13-14H,5-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.216 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | white to creamy-white crystalline powder |
| Specification: |
4-(4'-Chlorophenyl)-4-piperidinol , its cas register number is 39512-49-7. It also can be called 4-(p-Chlorophenyl)piperidin-4-ol ; 4-Piperidinol, 4-(4-chlorophenyl)- ; Haloperidol metabolite I . It is a white to creamy-white crystalline powder. |
| HS Code: | 29333999 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
