| Identification | |
| Name: | Methoxyethyl 3-nitrobenzylidenacetoacetate |
| Synonyms: | 2-Methoxyethyl2-(3-nitrobenzylidene)acetoacetate;2-Methoxyethyl 2-(m-nitrobenzylidene)acetoacetate;Methoxyethyl 3 -Nitrobenzylidenacetoacetate; |
| CAS: | 39562-22-6 |
| EINECS: | 254-511-0 |
| Molecular Formula: | C14H15NO6 |
| Molecular Weight: | 293.30 |
| InChI: | InChI=1/C14H15NO6/c1-10(16)13(14(17)21-7-6-20-2)9-11-4-3-5-12(8-11)15(18)19/h3-5,8-9H,6-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.266 g/cm3 |
| Refractive index: | 1.563 |
| Appearance: | a white crystalline |
| Specification: |
Methoxyethyl 3-nitrobenzylidenacetoacetate , with CAS number of 24549-06-2, can be called 2-Methoxyethyl 2-((3-nitrophenyl)methylene)acetoacetate ; 2-Methoxyethyl 2-acetyl-3-(3-nitrophenyl)acrylate ; Methoxyrthyl-3-nitrobenzylidenacetoacetate ; 3-Nitrobenzylideneacetoacetate-2-methoxyethylester . It is a a white crystalline. |
| Safety Data | |
 |
|
