| Identification |
| Name: | 3-(4-chlorophenoxy)-2-hydroxypropyl phenoxyacetate |
| Synonyms: | 3-(4-Chlorophenoxy)-2-hydroxypropyl phenoxyacetate;BRN 3003891;Acetic acid, phenoxy-, 3-(4-chlorophenoxy)-2-hydroxypropyl ester;AC1Q3RGX;AC1L53IK;AR-1E6834;LS-12697;[3-(4-chlorophenoxy)-2-hydroxypropyl] 2-phenoxyacetate |
| CAS: | 39719-57-8 |
| Molecular Formula: | C17H17ClO5 |
| Molecular Weight: | 336.7669 |
| InChI: | InChI=1/C17H17ClO5/c18-13-6-8-16(9-7-13)21-10-14(19)11-23-17(20)12-22-15-4-2-1-3-5-15/h1-9,14,19H,10-12H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 260°C |
| Boiling Point: | 506.3°C at 760 mmHg |
| Density: | 1.289g/cm3 |
| Refractive index: | 1.571 |
| Flash Point: | 260°C |
| Safety Data |
| |
 |