| Identification |
| Name: | 1-Propanone,2,3-dibromo-1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)- |
| Synonyms: | Propiophenone,2,3-dibromo-2'-hydroxy-3-(p-methoxyphenyl)- (7CI); NSC 75526 |
| CAS: | 39729-17-4 |
| Molecular Formula: | C16H14 Br2 O3 |
| Molecular Weight: | 414.0886 |
| InChI: | InChI=1/C16H14Br2O3/c1-21-11-8-6-10(7-9-11)14(17)15(18)16(20)12-4-2-3-5-13(12)19/h2-9,14-15,19H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 241.7°C |
| Boiling Point: | 476°Cat760mmHg |
| Density: | 1.669g/cm3 |
| Refractive index: | 1.64 |
| Flash Point: | 241.7°C |
| Safety Data |
| |
 |