| Identification | |
| Name: | 3-Pyridinamine,2-chloro-6-methyl- |
| Synonyms: | (2-Chloro-6-methyl-3-pyridinyl)amine;2-Chloro-3-amino-6-methylpyridine;3-Amino-2-chloro-6-methylpyridine; |
| CAS: | 39745-40-9 |
| Molecular Formula: | C6H7ClN2 |
| Molecular Weight: | 142.5862 |
| InChI: | InChI=1/C6H7ClN2/c1-4-2-3-5(8)6(7)9-4/h2-3H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 88-91 oC |
| Flash Point: | 112.5 oC |
| Boiling Point: | 262.3 oCat 760 mmHg |
| Density: | 1.26 g/cm3 |
| Refractive index: | 1.592 |
| Appearance: | Cream to tan crystalline powder |
| Specification: |
3-Pyridinamine,2-chloro-6-methyl- , its cas register number is 39745-40-9. It also can be called 2-Chloro-6-methylpyridin-3-amine . 3-Pyridinamine,2-chloro-6-methyl- (CAS NO.39745-40-9) is irritating to eyes, respiratory system and skin. And It's also harmful by inhalation, in contact with skin and if swallowed. |
| Flash Point: | 112.5 oC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
