| Identification | |
| Name: | Methyl 3-oxoheptanoate |
| Synonyms: | 3-Oxoheptanoicacid methyl ester;Methyl pentanoylacetate; |
| CAS: | 39815-78-6 |
| Molecular Formula: | C8H14O3 |
| Molecular Weight: | 158.19 |
| InChI: | InChI=1/C8H14O3/c1-3-4-5-7(9)6-8(10)11-2/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 0.981 g/cm3 |
| Density: | 0.994 g/mL at 20 °C(lit.) |
| Refractive index: | 1.421 |
| Specification: |
Methyl 3-oxoheptanoate , with CAS number is 39815-78-6, can be called Methyl valerylacetate ; 3-Ketoheptanoic acid methyl ester ; 3-Oxoenanthic acid methyl ester ; 3-Oxoheptanoic acid methyl ester ; VEM ; Methyl 3-oxoheptanoate, wacker quality . |
| Safety Data | |
 |
|
