| Identification | |
| Name: | Methanamine,1-methoxy-N-methyl-N-nitroso- |
| Synonyms: | (Methoxymethyl)methylnitrosoamine;Methoxymethyl(methylnitrosamine) |
| CAS: | 39885-14-8 |
| Molecular Formula: | C3H8 N2 O2 |
| Molecular Weight: | 104.13 |
| InChI: | InChI=1/C3H8N2O2/c1-5(4-6)3-7-2/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 67.4°C |
| Boiling Point: | 187.8°Cat760mmHg |
| Density: | 1.06g/cm3 |
| Refractive index: | 1.429 |
| Specification: |
Methoxymethyl-methylnitrosamine , its cas register number is 39885-14-8. It also can be called Methoxymethyl-methylnitrosamin ; Methyl(methoxymethyl)nitrosamine ; and N-Nitroso-N-methoxymethylmethylamine . Its classification code is Tumor data . |
| Flash Point: | 67.4°C |
| Safety Data | |
 |
|
