| Identification |
| Name: | Acetamide,N-(2-fluorophenyl)- |
| Synonyms: | Acetanilide,2'-fluoro- (6CI,7CI,8CI);2'-Fluoroacetanilide;N-(2-Fluorophenyl)acetamide;NSC 51783;o-Fluoroacetanilide; |
| CAS: | 399-31-5 |
| EINECS: | 206-916-9 |
| Molecular Formula: | C8H8FNO |
| Molecular Weight: | 153.15 |
| InChI: | InChI=1/C8H8FNO/c1-6(11)10-8-5-3-2-4-7(8)9/h2-5H,1H3,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.208g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.447 |
| Appearance: | White to off-white powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
