| Identification | |
| Name: | 8-Hydroxy-5-nitroquinoline |
| Synonyms: | 5-Nitro-8-quinolinol; Nitroxoline; 5-Nitro-8-hydroxyquinoline |
| CAS: | 4008-48-4 |
| EINECS: | 223-662-4 |
| Molecular Formula: | C9H6N2O3 |
| Molecular Weight: | 190.16 |
| InChI: | InChI=1/C9H6N2O3/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8/h1-5,12H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 419 °C at 760mmHg |
| Boiling Point: | 419 °C at 760mmHg |
| Density: | 1.496 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.728 |
| Solubility: | Very soluble |
| Appearance: | ochre-yellow to brownish crystalline powder |
| Specification: | ochre-yellow to brownish crystalline powder Safety Statements:26-36-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 419 °C at 760mmHg |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | An antibiotic. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
