| Identification | |
| Name: | 4-Aminomethyl-1-methylpyrazole |
| Synonyms: | C-(1-Methyl-1H-pyrazol-4-yl)methylamine;4-(Aminomethyl)-1-Methylpyrazole;[(1-Methyl-1H-pyrazol-4-yl)methyl]amine; |
| CAS: | 400877-05-6 |
| Molecular Formula: | C5H9N3 |
| Molecular Weight: | 111.15 |
| InChI: | InChI=1/C5H9N3/c1-8-4-5(2-6)3-7-8/h3-4H,2,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 87 ºC |
| Boiling Point: | 220 ºC |
| Density: | 1.16 |
| Refractive index: | 1.579 |
| Specification: |
The 4-Aminomethyl-1-methylpyrazole with the CAS number 400877-05-6 is also called C-(1-Methyl-1H-pyrazol-4-yl)methylamine. The IUPAC name is (1-methylpyrazol-4-yl)methanamine. Its molecular formula is C5H9N3. This chemical is irritant. While using this chemical, you should be very cautious. The properties of the chemical are: (1)# of Rule of 5 Violations: 0; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 3; (7)#H bond donors: 2; (8)#Freely Rotating Bonds: 2; (9)Polar Surface Area: 21.06 Å2; (10)Index of Refraction: 1.579; (11)Molar Refractivity: 31.77 cm3; (12)Molar Volume: 95.5 cm3; (13)Polarizability: 12.59×10-24cm3; (14)Surface Tension: 44 dyne/cm; (15)Enthalpy of Vaporization: 45.62 kJ/mol; (16)Vapour Pressure: 0.117 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 87 ºC |
| Safety Data | |
 |
|
