| Identification | |
| Name: | Acetic acid,2-fluoro-2-iodo-, ethyl ester |
| Synonyms: | Aceticacid, fluoroiodo-, ethyl ester (6CI,8CI,9CI);Ethyl fluoroiodoacetate;Ethyliodofluoroacetate; |
| CAS: | 401-58-1 |
| Molecular Formula: | C4H6FIO2 |
| Molecular Weight: | 231.99 |
| InChI: | InChI=1/C4H6FIO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Flash Point: | 60.3°C |
| Boiling Point: | 176.2°Cat760mmHg |
| Density: | 1.89g/cm3 |
| Refractive index: | 1.489 |
| Solubility: | 176.2°Cat760mmHg |
| Specification: | Safety Statements:16-26-36 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 60.3°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
