| Identification | |
| Name: | 3-CHLOROCATECHOL |
| Synonyms: | 1-CHLORO-2,3-DIHYDROXYBENZENE;3-CHLOROCATECHOL;3-MONOCHLOROCATECHOL;3-CHLOROCATECHOL 98+%;3-Chloro-1,2-benzenediol;3-Chloropyrocatechol;3-chlorobenzene-1,2-diol |
| CAS: | 4018-65-9 |
| Molecular Formula: | C6H5ClO2 |
| Molecular Weight: | 144.56 |
| InChI: | InChI=1/C6H5ClO2/c7-4-2-1-3-5(8)6(4)9/h1-3,8-9H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 49 °C |
| Flash Point: | 97.1°C |
| Boiling Point: | 138 °C / 20mmHg |
| Density: | 1.471g/cm3 |
| Refractive index: | 1.629 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 97.1°C |
| Safety Data | |
 |
|
