| Identification | |
| Name: | 5-Acetylsalicylamide |
| Synonyms: | 5-Acetylsalicylamide/5-Acetosalicylamide; 5-Acetosalicylamide; 5-Acetyl-2-hydroxybenzamide |
| CAS: | 40187-51-7 |
| EINECS: | 254-830-5 |
| Molecular Formula: | C9H9NO3 |
| Molecular Weight: | 179.17 |
| InChI: | InChI=1/C9H9NO3/c1-5(11)6-2-3-8(12)7(4-6)9(10)13/h2-4,12H,1H3,(H2,10,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.297 g/cm3 |
| Refractive index: | 1.597 |
| Appearance: | Off white to yellowish crystalline powder |
| Specification: | cream to beige powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
