| Identification | |
| Name: | 5-Fluoronicotinic acid |
| Synonyms: | 3-Pyridinecarboxylic acid, 5-fluoro-;5-fluoropyridine-3-carboxylic acid;Nicotinic acid, 5-fluoro-;5-Fluoro-3-pyridinecarboxylic acid; |
| CAS: | 402-66-4 |
| Molecular Formula: | C6H4FNO2 |
| Molecular Weight: | 141.1 |
| InChI: | InChI=1/C6H4FNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 118.4 ºC |
| Boiling Point: | 272.2ºC at 760 mmHg |
| Density: | 1.419 g/cm3 |
| Refractive index: | 1.534 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 118.4 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
