Identification |
Name: | 6-Fluoropyridine-2-carboxylic acid |
Synonyms: | 6-Fluoropicolinic acid; 2-Pyridinecarboxylic acid, 6-fluoro- |
CAS: | 402-69-7 |
EINECS: | None |
Molecular Formula: | C6H4FNO2 |
Molecular Weight: | 141.1 |
InChI: | InChI=1/C5H3BrFN/c6-5-4(7)2-1-3-8-5/h1-3H |
Molecular Structure: |
 |
Properties |
Density: | 1.419 g/cm3 |
Refractive index: | 1.533 |
Appearance: | White powder |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |