| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 3-methyl- |
| Synonyms: | Isonicotinicacid, 3-methyl- (6CI,7CI,8CI);3-Methyl-4-pyridinecarboxylic acid;3-Methylisonicotinic acid; |
| CAS: | 4021-12-9 |
| Molecular Formula: | C7H7NO2 |
| Molecular Weight: | 137.136 |
| InChI: | InChI=1/C7H7NO2/c1-5-4-8-3-2-6(5)7(9)10/h2-4H,1H3,(H,9,10)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.23g/cm3 |
| Specification: |
3-Methyl-4-pyridinecarboxylic acid , with CAS number of 4021-12-9, can be called 4-pyridinecarboxylic acid, 3-methyl- ; 3-Methyl-isonicotinic acid ; 3-methylpyridine-4-carboxylic acid . |
| Usage: | An Isonicotinic Acid (I821760) derivative. Used in the preparation of 4,5-dihydro-1H-pyrazole derivatives as cholesterol 24 hydroxylase inhibitors for prevention and/or treatment of neurodegenerative disease. |
| Safety Data | |
 |
|
