| Identification | |
| Name: | Benzoic acid,3-fluoro-4-methoxy- |
| Synonyms: | p-Anisicacid, 3-fluoro- (7CI,8CI);4-Methoxy-3-fluorobenzoic acid; |
| CAS: | 403-20-3 |
| EINECS: | -0 |
| Molecular Formula: | C8H7FO3 |
| Molecular Weight: | 170.14 |
| InChI: | InChI=1/C8H7FO3/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4H,1H3,(H,10,11)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 167°C |
| Boiling Point: | 352.5°Cat760mmHg |
| Density: | 1.568g/cm3 |
| Appearance: | white to off-white crystalline powder |
| Specification: | white to off-white crystalline powder Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 167°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
