| Identification | |
| Name: | Benzoicacid, 2-fluoro-4-nitro- |
| Synonyms: | NSC 190361;2-fluoro-4-nitrobenzenecarboxylic acid; |
| CAS: | 403-24-7 |
| EINECS: | -0 |
| Molecular Formula: | C7H4FNO4 |
| Molecular Weight: | 185.11 |
| InChI: | InChI=1/C7H4FNO4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.568 g/cm3 |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powder Safety Statements:26-37/39-36/37/39-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 22:Do not breathe dust |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
