| Identification |
| Name: | Benzenemethanol,4-fluoro-a-methyl- |
| Synonyms: | Benzylalcohol, p-fluoro-a-methyl- (7CI,8CI);1-(p-Fluorophenyl)ethanol;4-Fluoro-a-methylbenzenemethanol;4-Fluoro-a-methylbenzyl alcohol;NSC 2983;p-Fluoro-a-methylbenzyl alcohol;a-Methyl-4-fluorobenzyl alcohol; |
| CAS: | 403-41-8 |
| EINECS: | 206-959-3 |
| Molecular Formula: | C8H9FO |
| Molecular Weight: | 140.16 |
| InChI: | InChI=1/C8H9FO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 9.3 |
| Density: | 1.109 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5-1.502 |
| Appearance: | clear light yellow liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
