| Identification | |
| Name: | 3-Fluorobenzonitrile |
| Synonyms: | 3-fluoro-benzonitrile; m-Fluorobenzonitrile; FLUOROBENZONITRILE; 3-fluoro-benzonitril; Benzonitrile, m-fluoro-; m-Cyanofluorobenzene; m-Fluorobenzonitrile 3-Fluorobenzonitrile; 3-Fluorobenzonitrile,98%; 3-cyanofluorobenzene; M-FLUOROBENZONITILE |
| CAS: | 403-54-3 |
| EINECS: | 206-963-5 |
| Molecular Formula: | C7H4FN |
| Molecular Weight: | 121.11 |
| InChI: | InChI=1/C7H4FN/c8-7-3-1-2-6(4-7)5-9/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3276 |
| Density: | 1.133 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5043-1.5063 |
| Appearance: | Clear very slight yellow solid. |
| Specification: | clear colorless to yellow liquid Safety Statements:26-39-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
