| Identification | |
| Name: | 3-Fluoro-DL-tyrosine |
| Synonyms: | dl-3-fluorotyrosine; H-DL-Tyr(3-F)-OH |
| CAS: | 403-90-7 |
| EINECS: | 206-964-0 |
| Molecular Formula: | C9H10FNO3 |
| Molecular Weight: | 199.179003 |
| InChI: | InChI=1S/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Flash Point: | 172.9°C |
| Boiling Point: | 362.4°Cat760mmHg |
| Density: | 1.421g/cm3 |
| Stability: | Stable. Incompatible with strong reducing agents, strong oxidizing agents. |
| Refractive index: | 1.591 |
| Water Solubility: | slight Stability Stable. Incompatible with strong reducing agents,strong oxidizing agents. Toxicology Toxic by ingestion. Toxicity data (The meaning of any toxic |
| Solubility: | slight
|
| Appearance: | white solid |
| Specification: | white solid Safety Statements:36 36:Wear suitable protective clothing |
| Packinggroup: | II |
| Flash Point: | 172.9°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
