| Identification | |
| Name: | 1-Pentene, 3-ethyl- |
| Synonyms: | 3-Ethyl-1-pentene;NSC 74138 |
| CAS: | 4038-04-4 |
| EINECS: | 223-723-5 |
| Molecular Formula: | C7H14 |
| Molecular Weight: | 98.19 |
| InChI: | InChI=1/C7H14/c1-4-7(5-2)6-3/h4,7H,1,5-6H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 3/PG 2 |
| Flash Point: | °C |
| Boiling Point: | 85.4°Cat760mmHg |
| Density: | 0.703g/cm3 |
| Refractive index: | n20/D 1.398 |
| Specification: | Safety Statements:16-62 16:Keep away from sources of ignition - No smoking 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label |
| Packinggroup: | I |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xn: Harmful
|
 |
|
