Identification |
Name: | 1-(2-PHENYLETHYL)HOMOPIPERAZINE |
Synonyms: | BUTTPARK 85\06-08;1-(2-PHENYLETHYL)HOMOPIPERAZINE;1-(2-Phenylethyl)-1,4-diazepane;[(1-Phenyl-ethylcarbamoyl)-methyl]-carbamicacidtert-butylester |
CAS: | 40389-67-1 |
Molecular Formula: | C13H20N2 |
Molecular Weight: | 204.31 |
InChI: | InChI=1/C13H20N2/c1-2-5-13(6-3-1)7-11-15-10-4-8-14-9-12-15/h1-3,5-6,14H,4,7-12H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 124.4°C |
Boiling Point: | 310.8°C at 760 mmHg |
Density: | 0.974g/cm3 |
Refractive index: | 1.52 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 124.4°C |
Safety Data |
|
 |