| Identification |
| Name: | 3-(8-chloro-5-hydroxy-4-phenyl-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-N,N-dimethylpropan-1-aminium (2Z)-3-carboxyprop-2-enoate |
| Synonyms: | 4-Phenyl-5-(3-dimethylaminopropyl)-8-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-ol maleate;1-Benzoxepin-5-ol, 2,3,4,5-tetrahydro-8-chloro-5-(3-(dimethylamino)propyl)-4-phenyl-, (Z)-2-butenedioate (1:1) (salt);AC1O5HMB;LS-42485;3-(8-chloro-5-hydroxy-4-phenyl-3,4-dihydro-2H-1-benzoxepin-5-yl)propyl-dimethylazanium; (Z)-4-hydroxy-4-oxobut-2-enoate;40400-36-0 |
| CAS: | 40400-36-0 |
| Molecular Formula: | C25H30ClNO6 |
| Molecular Weight: | 475.9618 |
| InChI: | InChI=1/C21H26ClNO2.C4H4O4/c1-23(2)13-6-12-21(24)18(16-7-4-3-5-8-16)11-14-25-20-15-17(22)9-10-19(20)21;5-3(6)1-2-4(7)8/h3-5,7-10,15,18,24H,6,11-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 242.3°C |
| Boiling Point: | 477°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 242.3°C |
| Safety Data |
| |
 |