| Identification | |
| Name: | Naphthalene,2,7-bis(1-methylethyl)- |
| Synonyms: | Naphthalene,2,7-diisopropyl- (6CI); 2,7-Diisopropylnaphthalene; 3,6-Diisopropylnaphthalene |
| CAS: | 40458-98-8 |
| EINECS: | 254-929-3 |
| Molecular Formula: | C16H20 |
| Molecular Weight: | 212.33 |
| InChI: | InChI=1/C16H20/c1-11(2)14-7-5-13-6-8-15(12(3)4)10-16(13)9-14/h5-12H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3077 |
| Flash Point: | 142.5°C |
| Boiling Point: | 305.8°Cat760mmHg |
| Density: | 0.949g/cm3 |
| Refractive index: | 1.561 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 142.5°C |
| Safety Data | |
 |
|
