| Identification | |
| Name: | Benzonitrile,3-fluoro-4-hydroxy- |
| Synonyms: | 3-Fluoro-4-hydroxybenzonitrile;4-Cyano-2-fluorophenol;4-Hydroxy-3-fluorobenzonitrile; |
| CAS: | 405-04-9 |
| Molecular Formula: | C7H4FNO |
| Molecular Weight: | 137.11 |
| InChI: | InChI=1/C7H4FNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3439 |
| Flash Point: | 90.2°C |
| Boiling Point: | 225.6°Cat760mmHg |
| Density: | 1.35g/cm3 |
| Refractive index: | 1.558 |
| Specification: | Safety Statements:26-36/37/39-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 90.2°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
