| Identification | |
| Name: | Benzeneaceticacid, 4-fluoro- |
| Synonyms: | Aceticacid, (p-fluorophenyl)- (7CI,8CI);(4-Fluorophenyl)acetic acid;(p-Fluorophenyl)acetic acid;2-(4-Fluorophenyl)acetic acid;Ba 2821;NSC 402;4-Fluorophenylacetic acid; |
| CAS: | 405-50-5 |
| EINECS: | 206-972-4 |
| Molecular Formula: | C8H7FO2 |
| Molecular Weight: | 154.14 |
| InChI: | InChI=1/C8H7FO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.272 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | 8570 mg/L(25oC) |
| Solubility: | 8570 mg/L(25oC) |
| Appearance: | white shiny crystalline powder or flakes |
| Specification: |
? 4-Fluorophenylacetic acid (CAS No.405-50-5), it also can be called p-Fluorophenylacetic acid ; (4-Fluorophenyl)acetic acid ;Benzeneacetic acid, 4-fluoro- ;(4-Fluoro-phenyl)-acetic acid ; 2-(4-Fluorophenyl)Acetic Acid ; 4-Fluorophenylacetic acid 98% .It is white shiny crystalline powder or flakes. |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediate in the production of fluorinated anesthetics. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
