(S)-Azetidine-2-carboxylic acid hydrochloride (405226-56-4)

The (S)-Azetidine-2-carboxylic acid hydrochloride, with the CAS registry number 405226-56-4, is also known as 2-Azetidinecarboxylic acid, (2S)-, hydrochloride (1:1). This chemical's molecular formula is C₄H₈ClNO₂ and molecular weight is 137.56. Its systematic name is called (2S)-azetidine-2-carboxylic acid hydrochloride.

Physical properties of (S)-Azetidine-2-carboxylic acid hydrochloride: (1)#H bond acceptors: 3; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 1; (4)Polar Surface Area: 49.33 Å²; (5)Flash Point: 116.2 °C; (6)Enthalpy of Vaporization: 55.76 kJ/mol; (7)Boiling Point: 268.5 °C at 760 mmHg; (8)Vapour Pressure: 0.00218 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Cl.OC(=O)[C@@H]1CCN1
(2)InChI: InChI=1/C4H7NO2.ClH/c6-4(7)3-1-2-5-3;/h3,5H,1-2H2,(H,6,7);1H/t3-;/m0./s1
(3)InChIKey: LPAHPJVNLPAUNC-DFWYDOINBC