| Identification | |
| Name: | (S)-(+)-(2-Methylbutyl)benzene |
| Synonyms: | [(2S)-2-Methylbutyl]benzene; (S)-(+)-2-Benzylbutane |
| CAS: | 40560-30-3 |
| Molecular Formula: | C11H16 |
| Molecular Weight: | 148.24 |
| InChI: | InChI=1S/C11H16/c1-3-10(2)9-11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3/t10-/m1/s1 |
| Molecular Structure: | ![(C11H16) [(2S)-2-Methylbutyl]benzene; (S)-(+)-2-Benzylbutane](https://img.guidechem.com/structureimg/40560-30-3.gif) |
| Properties | |
| Flash Point: | 64oC |
| Boiling Point: | 197.3oCat760mmHg |
| Density: | 0.861g/cm3 |
| Specification: |
The (S)-(+)-(2-Methylbutyl)benzene with the cas number 40560-30-3, is also called [(2S)-2-Methylbutyl]benzene. The systematic name is Benzene, ((2S)-2-methylbutyl)-. Its system generated number is 0040560303. The molecular formula of this chemical is C11H16. It is a kind of organics. You can still convert the following datas into molecular structure: |
| Flash Point: | 64oC |
| Safety Data | |
 |
|
