| Identification | |
| Name: | Hydrazine,(2,4-difluorophenyl)- |
| Synonyms: | 1-(2,4-Difluorophenyl)hydrazine;2,4-Difluorophenylhydrazine; |
| CAS: | 40594-30-7 |
| Molecular Formula: | C6H6F2N2 |
| Molecular Weight: | 144.12 |
| InChI: | InChI=1/C6H6F2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 65.7°C |
| Boiling Point: | 185.1°C at 760 mmHg |
| Density: | 1.379 g/cm3 |
| Specification: | Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 65.7°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
