| Identification | |
| Name: | 1-Piperazinamine,4-methyl-, hydrochloride (1:2) |
| Synonyms: | 1-Piperazinamine,4-methyl-, dihydrochloride (9CI); Piperazine, 1-amino-4-methyl-,dihydrochloride (7CI); 1-Amino-4-methylpiperazine dihydrochloride;4-Methylpiperazin-1-ylamine dihydrochloride |
| CAS: | 40675-60-3 |
| EINECS: | 255-031-4 |
| Molecular Formula: | C5H13 N3 . 2 Cl H |
| Molecular Weight: | 206.11 |
| InChI: | InChI=1/C5H15N3/c1-7-2-4-8(6)5-3-7/h8H,2-5H2,1,6H3/q+2/p+1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 230 °C (dec.)(lit.) |
| Flash Point: | 58.1°C |
| Boiling Point: | 172.8°Cat760mmHg |
| Density: | g/cm3 |
| Specification: | WHITE FINE CRYSTALLINE POWDER Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 58.1°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
