| Identification |
| Name: | Benzoic acid,5-chloro-2-hydroxy-, methyl ester |
| Synonyms: | Salicylicacid, 5-chloro-, methyl ester (6CI,7CI,8CI);2-Hydroxy-5-chlorobenzoic acidmethyl ester;5-Chloro-2-hydroxybenzoic acid methyl ester;5-Chlorosalicylicacid methyl ester;Methyl 2-hydroxy-5-chlorobenzoate;Methyl5-chloro-2-hydroxybenzoate;Methyl 5-chlorosalicylate;NSC 85495;5-Chloro-2-hydeoxybenzoic acid methyl ester; |
| CAS: | 4068-78-4 |
| EINECS: | 223-778-5 |
| Molecular Formula: | C8H7ClO3 |
| Molecular Weight: | 186.59 |
| InChI: | InChI=1/C8H7ClO3/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4,10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.354 g/cm3 |
| Stability: | Decomposition will not occur if used and stored according to specifications. |
| Refractive index: | 1.564 |
| Solubility: | Insoluble |
| Appearance: | Solid. |
| Storage Temperature: | Keep container tightly sealed. Store in cool, dry conditions in well sealed containers. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
