| Identification | |
| Name: | 2-Fluoro-6-methylpyridine |
| Synonyms: | 2-Fluoro-6-picoline;2-fluoro-6-methyl-pyridine; |
| CAS: | 407-22-7 |
| EINECS: | 206-980-8 |
| Molecular Formula: | C6H6FN |
| Molecular Weight: | 111.12 |
| InChI: | InChI=1/C6H6FN/c1-5-3-2-4-6(7)8-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Flash Point: | 152? |
| Density: | 1.077 |
| Refractive index: | 1.47 |
| Appearance: | Colorless transparent liquid |
| Specification: | liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 152? |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
