| Identification | |
| Name: | 2-Propenoic acid,1,1'-(oxydi-2,1-ethanediyl) ester |
| Synonyms: | 2-Propenoicacid, oxydi-2,1-ethanediyl ester (9CI); Acrylic acid, oxydiethylene ester(7CI,8CI); Diethylene glycol, diacrylate (8CI); 2,2'-Oxydiethyl diacrylate;Kayarad DEGDA; NK Ester A 2G; Oxydiethylene diacrylate; SR 230; Sartomer SR230; TGA 2 |
| CAS: | 4074-88-8 |
| EINECS: | 223-791-6 |
| Molecular Formula: | C10H14 O5 |
| Molecular Weight: | 214.21 |
| InChI: | InChI=1/C10H14O5/c1-3-9(11)14-7-5-13-6-8-15-10(12)4-2/h3-4H,1-2,5-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2922 |
| Density: | 1.118 |
| Stability: | Stable. Incompatible with radical initiators, strong oxidizing agents, reducing agents, peroxides. Light sensitive. Polymerizes at elevated temperatures. |
| Refractive index: | 1.463 |
| Water Solubility: | 1-5 g/100 mL at 18 C |
| Solubility: | 1-5g/100mLat18C |
| Appearance: | colourless liquid |
| Specification: |
Diethylene glycol diacrylate (4074-88-8) also can be called Oxydiethane-2,1-diyl bisacrylate ; Oxydiethane-2,1-diyl bisprop-2-enoate ; Oxydi-2,1-ethanediyl bisacrylate and 2-propenoic acid, oxydi-2,1-ethanediyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Clear, colorless liquid /acrylate esters/ |
| Usage: | Useful for radiation curing by uv, beta, and gamma radiation, particularly adaptable for use in coatings or adhesive fields. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
