| Identification | |
| Name: | 3-Mercapto-2-butanone |
| Synonyms: | 2-Mercapto-3-butanone;3-Mercaptobutan-2-one;2-Butanone, 3-mercapto-; |
| CAS: | 40789-98-8 |
| EINECS: | 255-082-2 |
| Molecular Formula: | C4H8OS |
| Molecular Weight: | 104.16 |
| InChI: | InChI=1/C4H8OS/c1-3(5)4(2)6/h4,6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 2 |
| Flash Point: | 140 ºC at 760 mmHg |
| Boiling Point: | 140 ºC at 760 mmHg |
| Density: | 0.981 g/cm3 |
| Refractive index: | n20/D 1.4352 |
| Water Solubility: | slightly soluble in water; soluble in alcohol, ether, pyridine and aqueous alkalis |
| Solubility: | slightly soluble in water; soluble in alcohol, ether, pyridine and aqueous alkalis |
| Appearance: | colourless or pale yellow liquid, becomes cloudy after short storage |
| Specification: |
3-Mercapto-2-butanone (CAS NO.40789-98-8), its Synonyms are 2-Butanone, 3-mercapto- ; 2-Mercapto-3-butanone ; Mercapto-3 butanone-2 ; 3-Mercaptobutan-2-one . |
| Packinggroup: | III |
| Flash Point: | 140 ºC at 760 mmHg |
| Storage Temperature: | Refrigerator |
| Safety Data | |
 |
|
