| Identification | |
| Name: | Propanoic acid,2-[4-(2,4-dichlorophenoxy)phenoxy]- |
| CAS: | 40843-25-2 |
| EINECS: | 257-141-8 |
| Molecular Formula: | C15H12 Cl2 O4 |
| Molecular Weight: | 327.16 |
| InChI: | InChI=1/C15H12Cl2O4/c1-9(15(18)19)20-11-3-5-12(6-4-11)21-14-7-2-10(16)8-13(14)17/h2-9H,1H3,(H,18,19) |
| Molecular Structure: | ![(C15H12Cl2O4) (?à)-Diclofop;2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid;2-[4-(2',4'-Dichlorophenoxy)phenoxy]...](https://img1.guidechem.com/chem/e/dict/195/40843-25-2.jpg) |
| Properties | |
| Melting Point: | 39-40oC |
| Density: | 1.386 g/cm3 |
| Refractive index: | 1.593 |
| Water Solubility: | Solubility in water 0.8mg/L, easily to solve in acetone, xylene,toluene etc |
| Solubility: | Solubility in water 0.8mg/L, easily to solve in acetone, xylene,toluene etc |
| Appearance: | White powder. |
| Specification: |
The chemical synonyms of 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid (40843-25-2) are 2-(4-(2,4-Dichlorophenoxy)phenoxy)-propanoicaci ; Dichlorfopacid ; 2-(4-(2,4-Dichlorophenoxy)phenoxy)propanoic acid ; Hoe-021079 ; Diclofop ; Diclofop acid ; Diclofop (bsi,iso,ansi,wssa) . |
| Safety Data | |
 |
|
