Identification |
Name: | Phenol,2-amino-4-bromo- |
Synonyms: | 4-Bromo-2-aminophenol;NSC 523846;2-Amino-4-bromo-phenol;Phenol, 2-amino-4-bromo-;2-Amino-4-brombenzolol; |
CAS: | 40925-68-6 |
Molecular Formula: | C6H6BrNO |
Molecular Weight: | 188.02 |
InChI: | InChI=1/C6H6BrNO/c7-4-1-2-6(9)5(8)3-4/h1-3,9H,8H2 |
Molecular Structure: |
|
Properties |
Density: | 1.768 g/cm3 |
Refractive index: | 1.677 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
|
|