Identification |
Name: | Phenol,2-(1-methylbutyl)-4,6-dinitro- |
Synonyms: | 2,4-Dinitro-6-(1-methylbutyl)phenol;2-(1-Methyl-n-butyl)-4,6-dinitrophenol; 2-(2-Hydroxy-3,5-dinitrophenyl)pentane;2-sec-Amyl-4,6-dinitrophenol; Chemox General; DNAP; DNOSAP; Dinosam; NSC 21493 |
CAS: | 4097-36-3 |
Molecular Formula: | C11H14 N2 O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C11H14N2O5/c1-3-4-7(2)9-5-8(12(15)16)6-10(11(9)14)13(17)18/h5-7,14H,3-4H2,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | 3013 |
Flash Point: | 136.5°C |
Boiling Point: | 333.2°Cat760mmHg |
Density: | 1.306g/cm3 |
Refractive index: | 1.578 |
Specification: | Safety Statements:13-45-60-61 13:Keep away from food, drink and animal feeding stuffs 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 60:This material and/or its container must be disposed of
as hazardous waste 61:Avoid release to the environment. Refer to special instructions
safety data sheet |
Packinggroup: | II |
Flash Point: | 136.5°C |
Safety Data |
Hazard Symbols |
T: Toxic
N: Dangerous for the environment
|
|
|