| Identification | |
| Name: | Phenol,2-(1-methylbutyl)-4,6-dinitro- |
| Synonyms: | 2,4-Dinitro-6-(1-methylbutyl)phenol;2-(1-Methyl-n-butyl)-4,6-dinitrophenol; 2-(2-Hydroxy-3,5-dinitrophenyl)pentane;2-sec-Amyl-4,6-dinitrophenol; Chemox General; DNAP; DNOSAP; Dinosam; NSC 21493 |
| CAS: | 4097-36-3 |
| Molecular Formula: | C11H14 N2 O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H14N2O5/c1-3-4-7(2)9-5-8(12(15)16)6-10(11(9)14)13(17)18/h5-7,14H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3013 |
| Flash Point: | 136.5°C |
| Boiling Point: | 333.2°Cat760mmHg |
| Density: | 1.306g/cm3 |
| Refractive index: | 1.578 |
| Specification: | Safety Statements:13-45-60-61 13:Keep away from food, drink and animal feeding stuffs 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | II |
| Flash Point: | 136.5°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
N: Dangerous for the environment
|
 |
|
